About methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride
methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride (PubChem CID 135539449) has the molecular formula C8H14ClN5O3
and a molecular weight of 263.69 g/mol. Its IUPAC name is methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride |
| PubChem CID | 135539449 |
| Molecular Formula | C8H14ClN5O3 |
| Molecular Weight | 263.69 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride |
| SMILES | COC(=O)c1cn[nH]c1/N=N/N(C)CCO.Cl |
| InChI | InChI=1S/C8H13N5O3.ClH/c1-13(3-4-14)12-11-7-6(5-9-10-7)8(15)16-2;/h5,14H,3-4H2,1-2H3,(H,9,10);1H/b12-11+; |
| InChIKey | DIGCPLCTRLOWFF-CALJPSDSSA-N |
| XLogP | 0.54 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.69 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride?
The IUPAC name of methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride (CID 135539449) is methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride.
What is the SMILES notation for methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride?
The canonical SMILES for methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride is COC(=O)c1cn[nH]c1/N=N/N(C)CCO.Cl.
What is the InChIKey of methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride?
The InChIKey is DIGCPLCTRLOWFF-CALJPSDSSA-N. The full InChI is InChI=1S/C8H13N5O3.ClH/c1-13(3-4-14)12-11-7-6(5-9-10-7)8(15)16-2;/h5,14H,3-4H2,1-2H3,(H,9,10);1H/b12-11+;.
What are the key properties of methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride?
methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride has a molecular weight of 263.69 g/mol, XLogP of 0.54, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(E)-[2-hydroxyethyl(methyl)amino]diazenyl]-1H-pyrazole-4-carboxylate;hydrochloride is sourced from PubChem (CID 135539449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).