C8H7N3O5 — CID 135539625
5-oxido-3-(1,2,2-trihydroxyethenyl)-1,6-dihydropyrrolo[2,3-d]pyridazin-5-ium-7-one (PubChem CID 135539625) has the molecular formula C8H7N3O5 and a molecular weight of 225.16 g/mol. Its IUPAC name is 5-oxido-3-(1,2,2-trihydroxyethenyl)-1,6-dihydropyrrolo[2,3-d]pyridazin-5-ium-7-one.
| Compound Name | 5-oxido-3-(1,2,2-trihydroxyethenyl)-1,6-dihydropyrrolo[2,3-d]pyridazin-5-ium-7-one |
|---|---|
| PubChem CID | 135539625 |
| Molecular Formula | C8H7N3O5 |
| Molecular Weight | 225.16 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 5-oxido-3-(1,2,2-trihydroxyethenyl)-1,6-dihydropyrrolo[2,3-d]pyridazin-5-ium-7-one |
| SMILES | O=c1[nH][n+]([O-])cc2c(C(O)=C(O)O)c[nH]c12 |
| InChI | InChI=1S/C8H7N3O5/c12-6(8(14)15)3-1-9-5-4(3)2-11(16)10-7(5)13/h1-2,9,12,14-15H,(H,10,13) |
| InChIKey | LTRQRKXWGOGKBB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 136.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.16 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|