C25H28N2O5 — CID 135540035
3-[3-hydroxy-3-[2-(2-methoxyphenyl)imino-4,4-dimethyl-6-oxocyclohexylidene]propyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one (PubChem CID 135540035) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 3-[3-hydroxy-3-[2-(2-methoxyphenyl)imino-4,4-dimethyl-6-oxocyclohexylidene]propyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one.
| Compound Name | 3-[3-hydroxy-3-[2-(2-methoxyphenyl)imino-4,4-dimethyl-6-oxocyclohexylidene]propyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 135540035 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 3-[3-hydroxy-3-[2-(2-methoxyphenyl)imino-4,4-dimethyl-6-oxocyclohexylidene]propyl]-6,7-dihydro-5H-1,2-benzoxazol-4-one |
| SMILES | COc1ccccc1/N=C1\CC(C)(C)CC(=O)C1=C(O)CCc1noc2c1C(=O)CCC2 |
| InChI | InChI=1S/C25H28N2O5/c1-25(2)13-17(26-15-7-4-5-9-21(15)31-3)23(20(30)14-25)19(29)12-11-16-24-18(28)8-6-10-22(24)32-27-16/h4-5,7,9,29H,6,8,10-14H2,1-3H3/b23-19?,26-17+ |
| InChIKey | RHWSROFTAHRVMI-WLIDJCDKSA-N |
| XLogP | 5.11 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|