C24H34N2O4 — CID 135540143
3-[3-(2-tert-butylimino-4,4-dimethyl-6-oxocyclohexylidene)-3-hydroxypropyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one (PubChem CID 135540143) has the molecular formula C24H34N2O4 and a molecular weight of 414.55 g/mol. Its IUPAC name is 3-[3-(2-tert-butylimino-4,4-dimethyl-6-oxocyclohexylidene)-3-hydroxypropyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one.
| Compound Name | 3-[3-(2-tert-butylimino-4,4-dimethyl-6-oxocyclohexylidene)-3-hydroxypropyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one |
|---|---|
| PubChem CID | 135540143 |
| Molecular Formula | C24H34N2O4 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.25 |
| IUPAC Name | 3-[3-(2-tert-butylimino-4,4-dimethyl-6-oxocyclohexylidene)-3-hydroxypropyl]-6,6-dimethyl-5,7-dihydro-1,2-benzoxazol-4-one |
| SMILES | CC1(C)CC(=O)C(=C(O)CCc2noc3c2C(=O)CC(C)(C)C3)/C(=N/C(C)(C)C)C1 |
| InChI | InChI=1S/C24H34N2O4/c1-22(2,3)25-15-10-23(4,5)11-17(28)20(15)16(27)9-8-14-21-18(29)12-24(6,7)13-19(21)30-26-14/h27H,8-13H2,1-7H3/b20-16?,25-15+ |
| InChIKey | GMMVWICDSVWSJC-QTLZVNIOSA-N |
| XLogP | 5.20 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|