About 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol
4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol (PubChem CID 135540483) has the molecular formula C19H12F2N2O3
and a molecular weight of 354.31 g/mol. Its IUPAC name is 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol |
| PubChem CID | 135540483 |
| Molecular Formula | C19H12F2N2O3 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol |
| SMILES | Oc1ccc(-c2nn(-c3cc(F)ccc3F)c3cc(O)ccc23)c(O)c1 |
| InChI | InChI=1S/C19H12F2N2O3/c20-10-1-6-15(21)17(7-10)23-16-8-11(24)2-4-13(16)19(22-23)14-5-3-12(25)9-18(14)26/h1-9,24-26H |
| InChIKey | IRDQVQSLLZJRMS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol?
The IUPAC name of 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol (CID 135540483) is 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol.
What is the SMILES notation for 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol?
The canonical SMILES for 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol is Oc1ccc(-c2nn(-c3cc(F)ccc3F)c3cc(O)ccc23)c(O)c1.
What is the InChIKey of 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol?
The InChIKey is IRDQVQSLLZJRMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F2N2O3/c20-10-1-6-15(21)17(7-10)23-16-8-11(24)2-4-13(16)19(22-23)14-5-3-12(25)9-18(14)26/h1-9,24-26H.
What are the key properties of 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol?
4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol has a molecular weight of 354.31 g/mol, XLogP of 4.09, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(2,5-difluorophenyl)-6-hydroxyindazol-3-yl]benzene-1,3-diol is sourced from PubChem (CID 135540483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).