About methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate
methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate (PubChem CID 135540738) has the molecular formula C8H10F3NO4
and a molecular weight of 241.16 g/mol. Its IUPAC name is methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate.
Molecular Properties
| Compound Name | methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate |
| PubChem CID | 135540738 |
| Molecular Formula | C8H10F3NO4 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate |
| SMILES | [H]/N=C(/C(C(=O)OC)=C(O)COC)C(F)(F)F |
| InChI | InChI=1S/C8H10F3NO4/c1-15-3-4(13)5(7(14)16-2)6(12)8(9,10)11/h12-13H,3H2,1-2H3/b5-4?,12-6- |
| InChIKey | YJXUALJYKIGNQF-ZRYXPMGJSA-N |
| XLogP | 1.20 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate?
The IUPAC name of methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate (CID 135540738) is methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate.
What is the SMILES notation for methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate?
The canonical SMILES for methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate is [H]/N=C(/C(C(=O)OC)=C(O)COC)C(F)(F)F.
What is the InChIKey of methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate?
The InChIKey is YJXUALJYKIGNQF-ZRYXPMGJSA-N. The full InChI is InChI=1S/C8H10F3NO4/c1-15-3-4(13)5(7(14)16-2)6(12)8(9,10)11/h12-13H,3H2,1-2H3/b5-4?,12-6-.
What are the key properties of methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate?
methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate has a molecular weight of 241.16 g/mol, XLogP of 1.20, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-hydroxy-4-methoxy-2-(2,2,2-trifluoroethanimidoyl)but-2-enoate is sourced from PubChem (CID 135540738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).