C18H11NO5 — CID 135540944
18-hydroxy-16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one (PubChem CID 135540944) has the molecular formula C18H11NO5 and a molecular weight of 321.29 g/mol. Its IUPAC name is 18-hydroxy-16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one.
| Compound Name | 18-hydroxy-16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one |
|---|---|
| PubChem CID | 135540944 |
| Molecular Formula | C18H11NO5 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 18-hydroxy-16-methoxy-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,9,11,14(19),15,17-octaen-13-one |
| SMILES | COc1cc(O)c2c(c1)C(=O)c1nccc3cc4c(c-2c13)OCO4 |
| InChI | InChI=1S/C18H11NO5/c1-22-9-5-10-14(11(20)6-9)15-13-8(2-3-19-16(13)17(10)21)4-12-18(15)24-7-23-12/h2-6,20H,7H2,1H3 |
| InChIKey | COUOXHXNZGNBKD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |