C29H25ClN4O5 — CID 135541547
9-[(2R,3R,4S,5R)-5-[[(4-chlorophenyl)-diphenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one (PubChem CID 135541547) has the molecular formula C29H25ClN4O5 and a molecular weight of 545.00 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-5-[[(4-chlorophenyl)-diphenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,3R,4S,5R)-5-[[(4-chlorophenyl)-diphenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135541547 |
| Molecular Formula | C29H25ClN4O5 |
| Molecular Weight | 545.00 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-5-[[(4-chlorophenyl)-diphenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2[C@@H]1O[C@H](COC(c2ccccc2)(c2ccccc2)c2ccc(Cl)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C29H25ClN4O5/c30-21-13-11-20(12-14-21)29(18-7-3-1-4-8-18,19-9-5-2-6-10-19)38-15-22-24(35)25(36)28(39-22)34-17-33-23-26(34)31-16-32-27(23)37/h1-14,16-17,22,24-25,28,35-36H,15H2,(H,31,32,37)/t22-,24-,25-,28-/m1/s1 |
| InChIKey | WIERMBKITJHTJD-ZYWWQZICSA-N |
| XLogP | 3.40 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.00 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|