C29H26N4O4 — CID 135541548
9-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 135541548) has the molecular formula C29H26N4O4 and a molecular weight of 494.55 g/mol. Its IUPAC name is 9-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 9-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135541548 |
| Molecular Formula | C29H26N4O4 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 9-[(2R,4S,5R)-4-hydroxy-5-(trityloxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | O=c1[nH]cnc2c1ncn2[C@H]1C[C@H](O)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C29H26N4O4/c34-23-16-25(33-19-32-26-27(33)30-18-31-28(26)35)37-24(23)17-36-29(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,18-19,23-25,34H,16-17H2,(H,30,31,35)/t23-,24+,25+/m0/s1 |
| InChIKey | IIUOCTOEVNXRTP-ISJGIBHGSA-N |
| XLogP | 3.78 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|