C11H8N4OS — CID 135542040
7-amino-5-thiophen-3-yl-3H-pyrido[4,3-d]pyrimidin-4-one (PubChem CID 135542040) has the molecular formula C11H8N4OS and a molecular weight of 244.28 g/mol. Its IUPAC name is 7-amino-5-thiophen-3-yl-3H-pyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 7-amino-5-thiophen-3-yl-3H-pyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135542040 |
| Molecular Formula | C11H8N4OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 7-amino-5-thiophen-3-yl-3H-pyrido[4,3-d]pyrimidin-4-one |
| SMILES | Nc1cc2nc[nH]c(=O)c2c(-c2ccsc2)n1 |
| InChI | InChI=1S/C11H8N4OS/c12-8-3-7-9(11(16)14-5-13-7)10(15-8)6-1-2-17-4-6/h1-5H,(H2,12,15)(H,13,14,16) |
| InChIKey | UBFISQAOZQFWEQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |