C17H14N4O5S2 — CID 135542193
ethyl 2-[2-[(Z)-[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 135542193) has the molecular formula C17H14N4O5S2 and a molecular weight of 418.46 g/mol. Its IUPAC name is ethyl 2-[2-[(Z)-[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(Z)-[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 135542193 |
| Molecular Formula | C17H14N4O5S2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | ethyl 2-[2-[(Z)-[(5E)-5-[(4-nitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(/N=C2/NC(=O)/C(=C\c3ccc([N+](=O)[O-])cc3)S2)n1 |
| InChI | InChI=1S/C17H14N4O5S2/c1-2-26-14(22)8-11-9-27-16(18-11)20-17-19-15(23)13(28-17)7-10-3-5-12(6-4-10)21(24)25/h3-7,9H,2,8H2,1H3,(H,18,19,20,23)/b13-7+ |
| InChIKey | RZFVIQFEMVJNFN-NTUHNPAUSA-N |
| XLogP | 3.05 |
| TPSA | 123.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|