C18H15N3O5S2 — CID 135542194
4-[(E)-[(2Z)-2-[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid (PubChem CID 135542194) has the molecular formula C18H15N3O5S2 and a molecular weight of 417.47 g/mol. Its IUPAC name is 4-[(E)-[(2Z)-2-[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid.
| Compound Name | 4-[(E)-[(2Z)-2-[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 135542194 |
| Molecular Formula | C18H15N3O5S2 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | 4-[(E)-[(2Z)-2-[[4-(2-ethoxy-2-oxoethyl)-1,3-thiazol-2-yl]imino]-4-oxo-1,3-thiazolidin-5-ylidene]methyl]benzoic acid |
| SMILES | CCOC(=O)Cc1csc(/N=C2/NC(=O)/C(=C\c3ccc(C(=O)O)cc3)S2)n1 |
| InChI | InChI=1S/C18H15N3O5S2/c1-2-26-14(22)8-12-9-27-17(19-12)21-18-20-15(23)13(28-18)7-10-3-5-11(6-4-10)16(24)25/h3-7,9H,2,8H2,1H3,(H,24,25)(H,19,20,21,23)/b13-7+ |
| InChIKey | YRVLAWULLPVOGG-NTUHNPAUSA-N |
| XLogP | 2.84 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|