C17H13N5O7S2 — CID 135542198
ethyl 2-[2-[(Z)-[(5E)-5-[(2,4-dinitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazol-4-yl]acetate (PubChem CID 135542198) has the molecular formula C17H13N5O7S2 and a molecular weight of 463.45 g/mol. Its IUPAC name is ethyl 2-[2-[(Z)-[(5E)-5-[(2,4-dinitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(Z)-[(5E)-5-[(2,4-dinitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 135542198 |
| Molecular Formula | C17H13N5O7S2 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.03 |
| IUPAC Name | ethyl 2-[2-[(Z)-[(5E)-5-[(2,4-dinitrophenyl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(/N=C2/NC(=O)/C(=C\c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])S2)n1 |
| InChI | InChI=1S/C17H13N5O7S2/c1-2-29-14(23)6-10-8-30-16(18-10)20-17-19-15(24)13(31-17)5-9-3-4-11(21(25)26)7-12(9)22(27)28/h3-5,7-8H,2,6H2,1H3,(H,18,19,20,24)/b13-5+ |
| InChIKey | WIYXDRUNQCBDGS-WLRTZDKTSA-N |
| XLogP | 2.96 |
| TPSA | 166.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|