C52H46N4O8 — CID 135542238
5,10,15,20-tetrakis(3,5-dimethoxyphenyl)-21,23-dihydroporphyrin (PubChem CID 135542238) has the molecular formula C52H46N4O8 and a molecular weight of 854.96 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(3,5-dimethoxyphenyl)-21,23-dihydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(3,5-dimethoxyphenyl)-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135542238 |
| Molecular Formula | C52H46N4O8 |
| Molecular Weight | 854.96 g/mol |
| Exact Mass | 854.33 |
| IUPAC Name | 5,10,15,20-tetrakis(3,5-dimethoxyphenyl)-21,23-dihydroporphyrin |
| SMILES | COc1cc(OC)cc(-c2c3nc(c(-c4cc(OC)cc(OC)c4)c4ccc([nH]4)c(-c4cc(OC)cc(OC)c4)c4nc(c(-c5cc(OC)cc(OC)c5)c5ccc2[nH]5)C=C4)C=C3)c1 |
| InChI | InChI=1S/C52H46N4O8/c1-57-33-17-29(18-34(25-33)58-2)49-41-9-11-43(53-41)50(30-19-35(59-3)26-36(20-30)60-4)45-13-15-47(55-45)52(32-23-39(63-7)28-40(24-32)64-8)48-16-14-46(56-48)51(44-12-10-42(49)54-44)31-21-37(61-5)27-38(22-31)62-6/h9-28,53,56H,1-8H3/b49-41-,49-42-,50-43-,50-45-,51-44-,51-46-,52-47-,52-48- |
| InChIKey | YNXRFPUCCCJMPX-RCOMQYLTSA-N |
| XLogP | 11.39 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.96 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |