About 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea
1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea (PubChem CID 135542486) has the molecular formula C8H9N3O5
and a molecular weight of 227.18 g/mol. Its IUPAC name is 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea.
Molecular Properties
| Compound Name | 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea |
| PubChem CID | 135542486 |
| Molecular Formula | C8H9N3O5 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea |
| SMILES | O=C(NO)N/N=C/c1ccc(O)c(O)c1O |
| InChI | InChI=1S/C8H9N3O5/c12-5-2-1-4(6(13)7(5)14)3-9-10-8(15)11-16/h1-3,12-14,16H,(H2,10,11,15)/b9-3+ |
| InChIKey | AYZJFDNKNPLDAO-YCRREMRBSA-N |
| XLogP | -0.17 |
| TPSA | 134.41 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea?
The IUPAC name of 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea (CID 135542486) is 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea.
What is the SMILES notation for 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea?
The canonical SMILES for 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea is O=C(NO)N/N=C/c1ccc(O)c(O)c1O.
What is the InChIKey of 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea?
The InChIKey is AYZJFDNKNPLDAO-YCRREMRBSA-N. The full InChI is InChI=1S/C8H9N3O5/c12-5-2-1-4(6(13)7(5)14)3-9-10-8(15)11-16/h1-3,12-14,16H,(H2,10,11,15)/b9-3+.
What are the key properties of 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea?
1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea has a molecular weight of 227.18 g/mol, XLogP of -0.17, 2 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]urea is sourced from PubChem (CID 135542486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).