About 2,1,3-benzoxadiazol-4-ol
2,1,3-benzoxadiazol-4-ol (PubChem CID 135542663) has the molecular formula C6H4N2O2
and a molecular weight of 136.11 g/mol. Its IUPAC name is 2,1,3-benzoxadiazol-4-ol.
Molecular Properties
| Compound Name | 2,1,3-benzoxadiazol-4-ol |
| PubChem CID | 135542663 |
| Molecular Formula | C6H4N2O2 |
| Molecular Weight | 136.11 g/mol |
| Exact Mass | 136.03 |
| IUPAC Name | 2,1,3-benzoxadiazol-4-ol |
| SMILES | Oc1cccc2nonc12 |
| InChI | InChI=1S/C6H4N2O2/c9-5-3-1-2-4-6(5)8-10-7-4/h1-3,9H |
| InChIKey | JYVBLAKBEMDPBD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.11 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,1,3-benzoxadiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,1,3-benzoxadiazol-4-ol?
The IUPAC name of 2,1,3-benzoxadiazol-4-ol (CID 135542663) is 2,1,3-benzoxadiazol-4-ol.
What is the SMILES notation for 2,1,3-benzoxadiazol-4-ol?
The canonical SMILES for 2,1,3-benzoxadiazol-4-ol is Oc1cccc2nonc12.
What is the InChIKey of 2,1,3-benzoxadiazol-4-ol?
The InChIKey is JYVBLAKBEMDPBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2O2/c9-5-3-1-2-4-6(5)8-10-7-4/h1-3,9H.
What are the key properties of 2,1,3-benzoxadiazol-4-ol?
2,1,3-benzoxadiazol-4-ol has a molecular weight of 136.11 g/mol, XLogP of 0.93, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,1,3-benzoxadiazol-4-ol is sourced from PubChem (CID 135542663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).