About 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine
1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine (PubChem CID 135542897) has the molecular formula C8H10N4O4
and a molecular weight of 226.19 g/mol. Its IUPAC name is 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine.
Molecular Properties
| Compound Name | 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine |
| PubChem CID | 135542897 |
| Molecular Formula | C8H10N4O4 |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine |
| SMILES | N/C(=N/N=C/c1ccc(O)c(O)c1O)NO |
| InChI | InChI=1S/C8H10N4O4/c9-8(12-16)11-10-3-4-1-2-5(13)7(15)6(4)14/h1-3,13-16H,(H3,9,11,12)/b10-3+ |
| InChIKey | NXOZRLZDHJUNEK-XCVCLJGOSA-N |
| XLogP | -0.57 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine?
The IUPAC name of 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine (CID 135542897) is 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine.
What is the SMILES notation for 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine?
The canonical SMILES for 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine is N/C(=N/N=C/c1ccc(O)c(O)c1O)NO.
What is the InChIKey of 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine?
The InChIKey is NXOZRLZDHJUNEK-XCVCLJGOSA-N. The full InChI is InChI=1S/C8H10N4O4/c9-8(12-16)11-10-3-4-1-2-5(13)7(15)6(4)14/h1-3,13-16H,(H3,9,11,12)/b10-3+.
What are the key properties of 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine?
1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine has a molecular weight of 226.19 g/mol, XLogP of -0.57, 2 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2-[(E)-(2,3,4-trihydroxyphenyl)methylideneamino]guanidine is sourced from PubChem (CID 135542897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).