C10H6O6 — CID 135543374
2,3,5,8-tetrahydroxynaphthalene-1,4-dione (PubChem CID 135543374) has the molecular formula C10H6O6 and a molecular weight of 222.15 g/mol. Its IUPAC name is 2,3,5,8-tetrahydroxynaphthalene-1,4-dione.
| Compound Name | 2,3,5,8-tetrahydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 135543374 |
| Molecular Formula | C10H6O6 |
| Molecular Weight | 222.15 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | 2,3,5,8-tetrahydroxynaphthalene-1,4-dione |
| SMILES | O=C1C(O)=C(O)C(=O)c2c(O)ccc(O)c21 |
| InChI | InChI=1S/C10H6O6/c11-3-1-2-4(12)6-5(3)7(13)9(15)10(16)8(6)14/h1-2,11-12,15-16H |
| InChIKey | MECWRBUQZSSVHC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.15 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|