C16H19FN2O3S — CID 135543429
2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]-6-hydroxy-3-(2-methylpropyl)pyrimidin-4-one (PubChem CID 135543429) has the molecular formula C16H19FN2O3S and a molecular weight of 338.40 g/mol. Its IUPAC name is 2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]-6-hydroxy-3-(2-methylpropyl)pyrimidin-4-one.
| Compound Name | 2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]-6-hydroxy-3-(2-methylpropyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 135543429 |
| Molecular Formula | C16H19FN2O3S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-[(3-fluoro-4-methoxyphenyl)methylsulfanyl]-6-hydroxy-3-(2-methylpropyl)pyrimidin-4-one |
| SMILES | COc1ccc(CSc2nc(O)cc(=O)n2CC(C)C)cc1F |
| InChI | InChI=1S/C16H19FN2O3S/c1-10(2)8-19-15(21)7-14(20)18-16(19)23-9-11-4-5-13(22-3)12(17)6-11/h4-7,10,20H,8-9H2,1-3H3 |
| InChIKey | IZFUUBIEZHRVKD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |