C17H12N4O2S — CID 135543455
2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-3H-quinazolin-4-one (PubChem CID 135543455) has the molecular formula C17H12N4O2S and a molecular weight of 336.38 g/mol. Its IUPAC name is 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-3H-quinazolin-4-one.
| Compound Name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135543455 |
| Molecular Formula | C17H12N4O2S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]-3H-quinazolin-4-one |
| SMILES | O=c1[nH]c(SCc2nnc(-c3ccccc3)o2)nc2ccccc12 |
| InChI | InChI=1S/C17H12N4O2S/c22-15-12-8-4-5-9-13(12)18-17(19-15)24-10-14-20-21-16(23-14)11-6-2-1-3-7-11/h1-9H,10H2,(H,18,19,22) |
| InChIKey | WKWBINASSMSCNH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |