About 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol
6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol (PubChem CID 135543680) has the molecular formula C20H30N4O3
and a molecular weight of 374.49 g/mol. Its IUPAC name is 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol.
Molecular Properties
| Compound Name | 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol |
| PubChem CID | 135543680 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol |
| SMILES | CCN(CC)c1cc(-c2ccc(OC)c(CN3CCN(C)CC3)c2O)on1 |
| InChI | InChI=1S/C20H30N4O3/c1-5-24(6-2)19-13-18(27-21-19)15-7-8-17(26-4)16(20(15)25)14-23-11-9-22(3)10-12-23/h7-8,13,25H,5-6,9-12,14H2,1-4H3 |
| InChIKey | OIQMXDGNBVKDTC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol?
The IUPAC name of 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol (CID 135543680) is 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol.
What is the SMILES notation for 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol?
The canonical SMILES for 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol is CCN(CC)c1cc(-c2ccc(OC)c(CN3CCN(C)CC3)c2O)on1.
What is the InChIKey of 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol?
The InChIKey is OIQMXDGNBVKDTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N4O3/c1-5-24(6-2)19-13-18(27-21-19)15-7-8-17(26-4)16(20(15)25)14-23-11-9-22(3)10-12-23/h7-8,13,25H,5-6,9-12,14H2,1-4H3.
What are the key properties of 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol?
6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol has a molecular weight of 374.49 g/mol, XLogP of 2.65, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(diethylamino)-1,2-oxazol-5-yl]-3-methoxy-2-[(4-methylpiperazin-1-yl)methyl]phenol is sourced from PubChem (CID 135543680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).