C26H33N3O3S — CID 135543802
N-[[4-[[(7-hydroxy-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene)amino]methyl]cyclohexyl]methyl]benzenesulfonamide (PubChem CID 135543802) has the molecular formula C26H33N3O3S and a molecular weight of 467.64 g/mol. Its IUPAC name is N-[[4-[[(7-hydroxy-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene)amino]methyl]cyclohexyl]methyl]benzenesulfonamide.
| Compound Name | N-[[4-[[(7-hydroxy-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene)amino]methyl]cyclohexyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 135543802 |
| Molecular Formula | C26H33N3O3S |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-[[4-[[(7-hydroxy-1,3,3a,4,5,9b-hexahydrobenzo[e]indol-2-ylidene)amino]methyl]cyclohexyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCC(C/N=C2\CC3c4ccc(O)cc4CCC3N2)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H33N3O3S/c30-21-11-12-23-20(14-21)10-13-25-24(23)15-26(29-25)27-16-18-6-8-19(9-7-18)17-28-33(31,32)22-4-2-1-3-5-22/h1-5,11-12,14,18-19,24-25,28,30H,6-10,13,15-17H2,(H,27,29) |
| InChIKey | WVLBEZFZHMDGBG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|