C22H18N6O2 — CID 135544059
4-[8-(4-phenylphenyl)-1H-[1,2,4]triazolo[5,1-f]purin-5-yl]butanoic acid (PubChem CID 135544059) has the molecular formula C22H18N6O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is 4-[8-(4-phenylphenyl)-1H-[1,2,4]triazolo[5,1-f]purin-5-yl]butanoic acid.
| Compound Name | 4-[8-(4-phenylphenyl)-1H-[1,2,4]triazolo[5,1-f]purin-5-yl]butanoic acid |
|---|---|
| PubChem CID | 135544059 |
| Molecular Formula | C22H18N6O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-[8-(4-phenylphenyl)-1H-[1,2,4]triazolo[5,1-f]purin-5-yl]butanoic acid |
| SMILES | O=C(O)CCCc1nc2nc[nH]c2c2nc(-c3ccc(-c4ccccc4)cc3)nn12 |
| InChI | InChI=1S/C22H18N6O2/c29-18(30)8-4-7-17-25-21-19(23-13-24-21)22-26-20(27-28(17)22)16-11-9-15(10-12-16)14-5-2-1-3-6-14/h1-3,5-6,9-13H,4,7-8H2,(H,23,24)(H,29,30) |
| InChIKey | OYQOWKWBEOPZQB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |