About 5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one
5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one (PubChem CID 135544998) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one.
Analyze 5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one?
The IUPAC name of 5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one (CID 135544998) is 5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one.
What is the SMILES notation for 5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one?
The canonical SMILES for 5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one is Cc1[nH]c(C)c2c(=O)[nH]ncc12.
What is the InChIKey of 5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one?
The InChIKey is RPZBQNYRWHZMBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-4-6-3-9-11-8(12)7(6)5(2)10-4/h3,10H,1-2H3,(H,11,12).
What are the key properties of 5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one?
5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one has a molecular weight of 163.18 g/mol, XLogP of 0.87, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-2,6-dihydropyrrolo[3,4-d]pyridazin-1-one is sourced from PubChem (CID 135544998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).