C41H28N8 — CID 135545235
4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)aniline (PubChem CID 135545235) has the molecular formula C41H28N8 and a molecular weight of 632.73 g/mol. Its IUPAC name is 4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)aniline.
| Compound Name | 4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)aniline |
|---|---|
| PubChem CID | 135545235 |
| Molecular Formula | C41H28N8 |
| Molecular Weight | 632.73 g/mol |
| Exact Mass | 632.24 |
| IUPAC Name | 4-(10,15,20-tripyridin-4-yl-21,23-dihydroporphyrin-5-yl)aniline |
| SMILES | Nc1ccc(-c2c3nc(c(-c4ccncc4)c4ccc([nH]4)c(-c4ccncc4)c4nc(c(-c5ccncc5)c5ccc2[nH]5)C=C4)C=C3)cc1 |
| InChI | InChI=1S/C41H28N8/c42-29-3-1-25(2-4-29)38-30-5-7-32(46-30)39(26-13-19-43-20-14-26)34-9-11-36(48-34)41(28-17-23-45-24-18-28)37-12-10-35(49-37)40(27-15-21-44-22-16-27)33-8-6-31(38)47-33/h1-24,46,49H,42H2/b38-30-,38-31-,39-32-,39-34-,40-33-,40-35-,41-36-,41-37- |
| InChIKey | JDXGUPPOAYEPAF-NOAYMEMSSA-N |
| XLogP | 9.09 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.73 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|