About bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel
bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel (PubChem CID 135545236) has the molecular formula C34H26N6NiO4
and a molecular weight of 641.31 g/mol. Its IUPAC name is bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel.
Molecular Properties
| Compound Name | bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel |
| PubChem CID | 135545236 |
| Molecular Formula | C34H26N6NiO4 |
| Molecular Weight | 641.31 g/mol |
| Exact Mass | 640.14 |
| IUPAC Name | bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel |
| SMILES | Cc1ccc(/N=N/c2cc(C=O)c(O)c3ncccc23)cc1.Cc1ccc(/N=N/c2cc(C=O)c(O)c3ncccc23)cc1.[Ni] |
| InChI | InChI=1S/2C17H13N3O2.Ni/c2*1-11-4-6-13(7-5-11)19-20-15-9-12(10-21)17(22)16-14(15)3-2-8-18-16;/h2*2-10,22H,1H3;/b2*20-19+; |
| InChIKey | ULASGUARCSREIN-FFRZOONGSA-N |
| XLogP | 8.95 |
| TPSA | 149.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 641.31 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel?
The IUPAC name of bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel (CID 135545236) is bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel.
What is the SMILES notation for bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel?
The canonical SMILES for bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel is Cc1ccc(/N=N/c2cc(C=O)c(O)c3ncccc23)cc1.Cc1ccc(/N=N/c2cc(C=O)c(O)c3ncccc23)cc1.[Ni].
What is the InChIKey of bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel?
The InChIKey is ULASGUARCSREIN-FFRZOONGSA-N. The full InChI is InChI=1S/2C17H13N3O2.Ni/c2*1-11-4-6-13(7-5-11)19-20-15-9-12(10-21)17(22)16-14(15)3-2-8-18-16;/h2*2-10,22H,1H3;/b2*20-19+;.
What are the key properties of bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel?
bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel has a molecular weight of 641.31 g/mol, XLogP of 8.95, 6 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(8-hydroxy-5-[(4-methylphenyl)diazenyl]quinoline-7-carbaldehyde);nickel is sourced from PubChem (CID 135545236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).