C45H32N4O — CID 135545246
2-methoxy-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin (PubChem CID 135545246) has the molecular formula C45H32N4O and a molecular weight of 644.78 g/mol. Its IUPAC name is 2-methoxy-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin.
| Compound Name | 2-methoxy-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
|---|---|
| PubChem CID | 135545246 |
| Molecular Formula | C45H32N4O |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | 2-methoxy-5,10,15,20-tetraphenyl-21,23-dihydroporphyrin |
| SMILES | COc1cc2[nH]c1c(-c1ccccc1)c1nc(c(-c3ccccc3)c3ccc([nH]3)c(-c3ccccc3)c3nc(c2-c2ccccc2)C=C3)C=C1 |
| InChI | InChI=1S/C45H32N4O/c1-50-40-28-39-43(31-18-10-4-11-19-31)37-25-24-35(47-37)41(29-14-6-2-7-15-29)33-22-23-34(46-33)42(30-16-8-3-9-17-30)36-26-27-38(48-36)44(45(40)49-39)32-20-12-5-13-21-32/h2-28,46,49H,1H3/b41-33-,41-35-,42-34-,42-36-,43-37-,43-39-,44-38-,45-44- |
| InChIKey | XPRJCUFFOCDYLX-VKKWEVSDSA-N |
| XLogP | 11.33 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |