C19H26N6O — CID 135546026
1-cyclohexyl-3-[(E)-N'-(4,6,7-trimethylquinazolin-2-yl)carbamimidoyl]urea (PubChem CID 135546026) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(E)-N'-(4,6,7-trimethylquinazolin-2-yl)carbamimidoyl]urea.
| Compound Name | 1-cyclohexyl-3-[(E)-N'-(4,6,7-trimethylquinazolin-2-yl)carbamimidoyl]urea |
|---|---|
| PubChem CID | 135546026 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 1-cyclohexyl-3-[(E)-N'-(4,6,7-trimethylquinazolin-2-yl)carbamimidoyl]urea |
| SMILES | Cc1cc2nc(/N=C(\N)NC(=O)NC3CCCCC3)nc(C)c2cc1C |
| InChI | InChI=1S/C19H26N6O/c1-11-9-15-13(3)21-18(23-16(15)10-12(11)2)24-17(20)25-19(26)22-14-7-5-4-6-8-14/h9-10,14H,4-8H2,1-3H3,(H4,20,21,22,23,24,25,26) |
| InChIKey | CNXMLWKLOHBPKF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|