C14H9N3OPbS — CID 135546195
2-[(E)-1,3-benzothiazol-2-ylazanidyliminomethyl]phenolate;lead(2+) (PubChem CID 135546195) has the molecular formula C14H9N3OPbS and a molecular weight of 474.51 g/mol. Its IUPAC name is 2-[(E)-1,3-benzothiazol-2-ylazanidyliminomethyl]phenolate;lead(2+).
| Compound Name | 2-[(E)-1,3-benzothiazol-2-ylazanidyliminomethyl]phenolate;lead(2+) |
|---|---|
| PubChem CID | 135546195 |
| Molecular Formula | C14H9N3OPbS |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 475.02 |
| IUPAC Name | 2-[(E)-1,3-benzothiazol-2-ylazanidyliminomethyl]phenolate;lead(2+) |
| SMILES | [O-]c1ccccc1/C=N/[N-]c1nc2ccccc2s1.[Pb+2] |
| InChI | InChI=1S/C14H10N3OS.Pb/c18-12-7-3-1-5-10(12)9-15-17-14-16-11-6-2-4-8-13(11)19-14;/h1-9H,(H-,15,16,17,18);/q-1;+2/p-1 |
| InChIKey | HGGCNRJFPIYOLN-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 62.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|