C9H15N5O2 — CID 135546359
2-amino-6-(ethoxymethyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one (PubChem CID 135546359) has the molecular formula C9H15N5O2 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-amino-6-(ethoxymethyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one.
| Compound Name | 2-amino-6-(ethoxymethyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135546359 |
| Molecular Formula | C9H15N5O2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-amino-6-(ethoxymethyl)-5,6,7,8-tetrahydro-3H-pteridin-4-one |
| SMILES | CCOCC1CNc2nc(N)[nH]c(=O)c2N1 |
| InChI | InChI=1S/C9H15N5O2/c1-2-16-4-5-3-11-7-6(12-5)8(15)14-9(10)13-7/h5,12H,2-4H2,1H3,(H4,10,11,13,14,15) |
| InChIKey | NMIQOXGUPYGAFM-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 105.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |