C26H20ClN5O — CID 135546840
(E)-N-[7-(4-chlorophenyl)-5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3-phenylprop-2-enamide (PubChem CID 135546840) has the molecular formula C26H20ClN5O and a molecular weight of 453.93 g/mol. Its IUPAC name is (E)-N-[7-(4-chlorophenyl)-5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[7-(4-chlorophenyl)-5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 135546840 |
| Molecular Formula | C26H20ClN5O |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (E)-N-[7-(4-chlorophenyl)-5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1nc2n(n1)C(c1ccc(Cl)cc1)C=C(c1ccccc1)N2 |
| InChI | InChI=1S/C26H20ClN5O/c27-21-14-12-20(13-15-21)23-17-22(19-9-5-2-6-10-19)28-26-30-25(31-32(23)26)29-24(33)16-11-18-7-3-1-4-8-18/h1-17,23H,(H2,28,29,30,31,33)/b16-11+ |
| InChIKey | KKVAMWRMYQBMOO-LFIBNONCSA-N |
| XLogP | 5.64 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|