C23H28N2O3S — CID 135546904
4-methyl-1,1-dioxo-N-[(4-propan-2-yloxyphenyl)methyl]-5-(4-propan-2-ylphenyl)-1,2-thiazol-3-imine (PubChem CID 135546904) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 4-methyl-1,1-dioxo-N-[(4-propan-2-yloxyphenyl)methyl]-5-(4-propan-2-ylphenyl)-1,2-thiazol-3-imine.
| Compound Name | 4-methyl-1,1-dioxo-N-[(4-propan-2-yloxyphenyl)methyl]-5-(4-propan-2-ylphenyl)-1,2-thiazol-3-imine |
|---|---|
| PubChem CID | 135546904 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 4-methyl-1,1-dioxo-N-[(4-propan-2-yloxyphenyl)methyl]-5-(4-propan-2-ylphenyl)-1,2-thiazol-3-imine |
| SMILES | CC1=C(c2ccc(C(C)C)cc2)S(=O)(=O)N/C1=N\Cc1ccc(OC(C)C)cc1 |
| InChI | InChI=1S/C23H28N2O3S/c1-15(2)19-8-10-20(11-9-19)22-17(5)23(25-29(22,26)27)24-14-18-6-12-21(13-7-18)28-16(3)4/h6-13,15-16H,14H2,1-5H3,(H,24,25) |
| InChIKey | PAGAHGOXNOHATI-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|