About 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+)
4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+) (PubChem CID 135546965) has the molecular formula C12H10ClN3O2PtS
and a molecular weight of 490.83 g/mol. Its IUPAC name is 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+).
Molecular Properties
| Compound Name | 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+) |
| PubChem CID | 135546965 |
| Molecular Formula | C12H10ClN3O2PtS |
| Molecular Weight | 490.83 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+) |
| SMILES | Cc1c(O)c(/N=N/C(N)=S)c2ccccc2c1[O-].Cl[Pt+] |
| InChI | InChI=1S/C12H11N3O2S.ClH.Pt/c1-6-10(16)8-5-3-2-4-7(8)9(11(6)17)14-15-12(13)18;;/h2-5,16-17H,1H3,(H2,13,18);1H;/q;;+2/p-2/b15-14+;; |
| InChIKey | FCVQDFHTGUVQKN-NSKUCRDLSA-L |
| XLogP | 2.94 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.83 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+)?
The IUPAC name of 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+) (CID 135546965) is 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+).
What is the SMILES notation for 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+)?
The canonical SMILES for 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+) is Cc1c(O)c(/N=N/C(N)=S)c2ccccc2c1[O-].Cl[Pt+].
What is the InChIKey of 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+)?
The InChIKey is FCVQDFHTGUVQKN-NSKUCRDLSA-L. The full InChI is InChI=1S/C12H11N3O2S.ClH.Pt/c1-6-10(16)8-5-3-2-4-7(8)9(11(6)17)14-15-12(13)18;;/h2-5,16-17H,1H3,(H2,13,18);1H;/q;;+2/p-2/b15-14+;;.
What are the key properties of 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+)?
4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+) has a molecular weight of 490.83 g/mol, XLogP of 2.94, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(carbamothioyldiazenyl)-3-hydroxy-2-methylnaphthalen-1-olate;chloroplatinum(1+) is sourced from PubChem (CID 135546965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).