C26H27N5O2 — CID 135547602
3-(dimethylamino)-N-[3-[7-hydroxy-2-(propan-2-ylamino)quinazolin-6-yl]phenyl]benzamide (PubChem CID 135547602) has the molecular formula C26H27N5O2 and a molecular weight of 441.54 g/mol. Its IUPAC name is 3-(dimethylamino)-N-[3-[7-hydroxy-2-(propan-2-ylamino)quinazolin-6-yl]phenyl]benzamide.
| Compound Name | 3-(dimethylamino)-N-[3-[7-hydroxy-2-(propan-2-ylamino)quinazolin-6-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 135547602 |
| Molecular Formula | C26H27N5O2 |
| Molecular Weight | 441.54 g/mol |
| Exact Mass | 441.22 |
| IUPAC Name | 3-(dimethylamino)-N-[3-[7-hydroxy-2-(propan-2-ylamino)quinazolin-6-yl]phenyl]benzamide |
| SMILES | CC(C)Nc1ncc2cc(-c3cccc(NC(=O)c4cccc(N(C)C)c4)c3)c(O)cc2n1 |
| InChI | InChI=1S/C26H27N5O2/c1-16(2)28-26-27-15-19-13-22(24(32)14-23(19)30-26)17-7-5-9-20(11-17)29-25(33)18-8-6-10-21(12-18)31(3)4/h5-16,32H,1-4H3,(H,29,33)(H,27,28,30) |
| InChIKey | DOUWZYXJMBFUSC-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |