About 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol
3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol (PubChem CID 135548434) has the molecular formula C10H8N2O3
and a molecular weight of 204.18 g/mol. Its IUPAC name is 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol.
Molecular Properties
| Compound Name | 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol |
| PubChem CID | 135548434 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol |
| SMILES | O=Nc1c(O)[nH]c2c3c(ccc12)COC3 |
| InChI | InChI=1S/C10H8N2O3/c13-10-9(12-14)6-2-1-5-3-15-4-7(5)8(6)11-10/h1-2,11,13H,3-4H2 |
| InChIKey | MANGAYDXBGDFGG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol?
The IUPAC name of 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol (CID 135548434) is 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol.
What is the SMILES notation for 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol?
The canonical SMILES for 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol is O=Nc1c(O)[nH]c2c3c(ccc12)COC3.
What is the InChIKey of 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol?
The InChIKey is MANGAYDXBGDFGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c13-10-9(12-14)6-2-1-5-3-15-4-7(5)8(6)11-10/h1-2,11,13H,3-4H2.
What are the key properties of 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol?
3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol has a molecular weight of 204.18 g/mol, XLogP of 2.30, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitroso-6,8-dihydro-1H-furo[3,4-g]indol-2-ol is sourced from PubChem (CID 135548434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).