About N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide
N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 135548953) has the molecular formula C11H17N5O2S
and a molecular weight of 283.36 g/mol. Its IUPAC name is N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| PubChem CID | 135548953 |
| Molecular Formula | C11H17N5O2S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | Nc1nc(SCC(=O)NC2CCCC2)[nH]c(=O)c1N |
| InChI | InChI=1S/C11H17N5O2S/c12-8-9(13)15-11(16-10(8)18)19-5-7(17)14-6-3-1-2-4-6/h6H,1-5,12H2,(H,14,17)(H3,13,15,16,18) |
| InChIKey | GCBQEFALNGJADY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide?
The IUPAC name of N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide (CID 135548953) is N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide.
What is the SMILES notation for N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide?
The canonical SMILES for N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide is Nc1nc(SCC(=O)NC2CCCC2)[nH]c(=O)c1N.
What is the InChIKey of N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide?
The InChIKey is GCBQEFALNGJADY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5O2S/c12-8-9(13)15-11(16-10(8)18)19-5-7(17)14-6-3-1-2-4-6/h6H,1-5,12H2,(H,14,17)(H3,13,15,16,18).
What are the key properties of N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide?
N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide has a molecular weight of 283.36 g/mol, XLogP of 0.09, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2-[(4,5-diamino-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide is sourced from PubChem (CID 135548953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).