C20H23N3O3S2 — CID 135549158
2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanyl-N-(2-phenylethyl)butanamide (PubChem CID 135549158) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanyl-N-(2-phenylethyl)butanamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanyl-N-(2-phenylethyl)butanamide |
|---|---|
| PubChem CID | 135549158 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]-4-methylsulfanyl-N-(2-phenylethyl)butanamide |
| SMILES | CSCCC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-27-14-12-17(20(24)21-13-11-15-7-3-2-4-8-15)22-19-16-9-5-6-10-18(16)28(25,26)23-19/h2-10,17H,11-14H2,1H3,(H,21,24)(H,22,23) |
| InChIKey | DJOUPBZKAMPMMH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|