C18H24ClN3O2 — CID 135549351
4-[2-methyl-6-(2-piperidin-1-ylethoxy)pyrimidin-4-yl]phenol;hydrochloride (PubChem CID 135549351) has the molecular formula C18H24ClN3O2 and a molecular weight of 349.86 g/mol. Its IUPAC name is 4-[2-methyl-6-(2-piperidin-1-ylethoxy)pyrimidin-4-yl]phenol;hydrochloride.
| Compound Name | 4-[2-methyl-6-(2-piperidin-1-ylethoxy)pyrimidin-4-yl]phenol;hydrochloride |
|---|---|
| PubChem CID | 135549351 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 4-[2-methyl-6-(2-piperidin-1-ylethoxy)pyrimidin-4-yl]phenol;hydrochloride |
| SMILES | Cc1nc(OCCN2CCCCC2)cc(-c2ccc(O)cc2)n1.Cl |
| InChI | InChI=1S/C18H23N3O2.ClH/c1-14-19-17(15-5-7-16(22)8-6-15)13-18(20-14)23-12-11-21-9-3-2-4-10-21;/h5-8,13,22H,2-4,9-12H2,1H3;1H |
| InChIKey | XNJUOEJOEXPWSP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |