C13H10N6OS2 — CID 135549360
2-[5-(5-amino-3-prop-2-ynylsulfanyl-1,2,4-triazol-1-yl)-1,3,4-thiadiazol-2-yl]phenol (PubChem CID 135549360) has the molecular formula C13H10N6OS2 and a molecular weight of 330.40 g/mol. Its IUPAC name is 2-[5-(5-amino-3-prop-2-ynylsulfanyl-1,2,4-triazol-1-yl)-1,3,4-thiadiazol-2-yl]phenol.
| Compound Name | 2-[5-(5-amino-3-prop-2-ynylsulfanyl-1,2,4-triazol-1-yl)-1,3,4-thiadiazol-2-yl]phenol |
|---|---|
| PubChem CID | 135549360 |
| Molecular Formula | C13H10N6OS2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | 2-[5-(5-amino-3-prop-2-ynylsulfanyl-1,2,4-triazol-1-yl)-1,3,4-thiadiazol-2-yl]phenol |
| SMILES | C#CCSc1nc(N)n(-c2nnc(-c3ccccc3O)s2)n1 |
| InChI | InChI=1S/C13H10N6OS2/c1-2-7-21-12-15-11(14)19(18-12)13-17-16-10(22-13)8-5-3-4-6-9(8)20/h1,3-6,20H,7H2,(H2,14,15,18) |
| InChIKey | UPHADYVKJNENPX-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|