C18H16N6O2 — CID 135549809
2-ethoxy-4-[(E)-([1,2,4]triazolo[3,4-a]phthalazin-6-ylhydrazinylidene)methyl]phenol (PubChem CID 135549809) has the molecular formula C18H16N6O2 and a molecular weight of 348.37 g/mol. Its IUPAC name is 2-ethoxy-4-[(E)-([1,2,4]triazolo[3,4-a]phthalazin-6-ylhydrazinylidene)methyl]phenol.
| Compound Name | 2-ethoxy-4-[(E)-([1,2,4]triazolo[3,4-a]phthalazin-6-ylhydrazinylidene)methyl]phenol |
|---|---|
| PubChem CID | 135549809 |
| Molecular Formula | C18H16N6O2 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-ethoxy-4-[(E)-([1,2,4]triazolo[3,4-a]phthalazin-6-ylhydrazinylidene)methyl]phenol |
| SMILES | CCOc1cc(/C=N/Nc2nn3cnnc3c3ccccc23)ccc1O |
| InChI | InChI=1S/C18H16N6O2/c1-2-26-16-9-12(7-8-15(16)25)10-19-21-17-13-5-3-4-6-14(13)18-22-20-11-24(18)23-17/h3-11,25H,2H2,1H3,(H,21,23)/b19-10+ |
| InChIKey | YDHDGMFTIJVYJZ-VXLYETTFSA-N |
| XLogP | 2.83 |
| TPSA | 96.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|