C17H20F2N4O5 — CID 135550128
2-methoxyethyl (5S,6S,7R)-7-[4-(difluoromethoxy)phenyl]-5-hydroxy-5-methyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135550128) has the molecular formula C17H20F2N4O5 and a molecular weight of 398.37 g/mol. Its IUPAC name is 2-methoxyethyl (5S,6S,7R)-7-[4-(difluoromethoxy)phenyl]-5-hydroxy-5-methyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methoxyethyl (5S,6S,7R)-7-[4-(difluoromethoxy)phenyl]-5-hydroxy-5-methyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135550128 |
| Molecular Formula | C17H20F2N4O5 |
| Molecular Weight | 398.37 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 2-methoxyethyl (5S,6S,7R)-7-[4-(difluoromethoxy)phenyl]-5-hydroxy-5-methyl-6,7-dihydro-4H-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COCCOC(=O)[C@H]1[C@H](c2ccc(OC(F)F)cc2)n2ncnc2N[C@@]1(C)O |
| InChI | InChI=1S/C17H20F2N4O5/c1-17(25)12(14(24)27-8-7-26-2)13(23-16(22-17)20-9-21-23)10-3-5-11(6-4-10)28-15(18)19/h3-6,9,12-13,15,25H,7-8H2,1-2H3,(H,20,21,22)/t12-,13+,17+/m1/s1 |
| InChIKey | WMACCGIAZDLLKR-IGCXYCKISA-N |
| XLogP | 1.41 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|