C17H14N4O2S — CID 135550243
6-(2-benzylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-3H-1,3-benzoxazol-2-one (PubChem CID 135550243) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 6-(2-benzylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(2-benzylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 135550243 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 6-(2-benzylimino-3,6-dihydro-1,3,4-thiadiazin-5-yl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(C3=NN/C(=N/Cc4ccccc4)SC3)cc2o1 |
| InChI | InChI=1S/C17H14N4O2S/c22-17-19-13-7-6-12(8-15(13)23-17)14-10-24-16(21-20-14)18-9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,18,21)(H,19,22) |
| InChIKey | IGJDLVZHOVJKPR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|