C17H15N5O2S — CID 135550910
(NE,3Z)-N-[[4-(3,5-dimethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylidene]pyridine-3-carbohydrazonate (PubChem CID 135550910) has the molecular formula C17H15N5O2S and a molecular weight of 353.41 g/mol. Its IUPAC name is (NE,3Z)-N-[[4-(3,5-dimethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylidene]pyridine-3-carbohydrazonate.
| Compound Name | (NE,3Z)-N-[[4-(3,5-dimethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylidene]pyridine-3-carbohydrazonate |
|---|---|
| PubChem CID | 135550910 |
| Molecular Formula | C17H15N5O2S |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | (NE,3Z)-N-[[4-(3,5-dimethylpyridin-1-ium-1-yl)-2-oxo-3H-1,3-thiazol-5-yl]methylidene]pyridine-3-carbohydrazonate |
| SMILES | Cc1cc(C)c[n+](-c2[nH]c(=O)sc2/C=N/N=C(\[O-])c2cccnc2)c1 |
| InChI | InChI=1S/C17H15N5O2S/c1-11-6-12(2)10-22(9-11)15-14(25-17(24)20-15)8-19-21-16(23)13-4-3-5-18-7-13/h3-10H,1-2H3,(H-,19,20,21,23,24) |
| InChIKey | BSXHMEDNIOVSBH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_C(11)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|