C23H17N5O2 — CID 135550931
[4-(4-hydroxyanilino)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]-phenylmethanone (PubChem CID 135550931) has the molecular formula C23H17N5O2 and a molecular weight of 395.42 g/mol. Its IUPAC name is [4-(4-hydroxyanilino)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]-phenylmethanone.
| Compound Name | [4-(4-hydroxyanilino)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]-phenylmethanone |
|---|---|
| PubChem CID | 135550931 |
| Molecular Formula | C23H17N5O2 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | [4-(4-hydroxyanilino)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-8-yl]-phenylmethanone |
| SMILES | Cc1nnc2c(Nc3ccc(O)cc3)nc3ccc(C(=O)c4ccccc4)cc3n12 |
| InChI | InChI=1S/C23H17N5O2/c1-14-26-27-23-22(24-17-8-10-18(29)11-9-17)25-19-12-7-16(13-20(19)28(14)23)21(30)15-5-3-2-4-6-15/h2-13,29H,1H3,(H,24,25) |
| InChIKey | HPWJKSZOOVTZBD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|