C24H25ClN6O2 — CID 135553243
2-[4-[[1-(3-chlorophenyl)-3-hydroxypropan-2-yl]amino]-2-oxo-1H-pyridin-3-yl]-N',7-dimethyl-3H-benzimidazole-5-carboximidamide (PubChem CID 135553243) has the molecular formula C24H25ClN6O2 and a molecular weight of 464.96 g/mol. Its IUPAC name is 2-[4-[[1-(3-chlorophenyl)-3-hydroxypropan-2-yl]amino]-2-oxo-1H-pyridin-3-yl]-N',7-dimethyl-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-[4-[[1-(3-chlorophenyl)-3-hydroxypropan-2-yl]amino]-2-oxo-1H-pyridin-3-yl]-N',7-dimethyl-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 135553243 |
| Molecular Formula | C24H25ClN6O2 |
| Molecular Weight | 464.96 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 2-[4-[[1-(3-chlorophenyl)-3-hydroxypropan-2-yl]amino]-2-oxo-1H-pyridin-3-yl]-N',7-dimethyl-3H-benzimidazole-5-carboximidamide |
| SMILES | C/N=C(\N)c1cc(C)c2nc(-c3c(NC(CO)Cc4cccc(Cl)c4)cc[nH]c3=O)[nH]c2c1 |
| InChI | InChI=1S/C24H25ClN6O2/c1-13-8-15(22(26)27-2)11-19-21(13)31-23(30-19)20-18(6-7-28-24(20)33)29-17(12-32)10-14-4-3-5-16(25)9-14/h3-9,11,17,32H,10,12H2,1-2H3,(H2,26,27)(H,30,31)(H2,28,29,33) |
| InChIKey | ITBQRJLMIYQCJD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 132.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.96 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|