C29H30N6O5 — CID 135553779
7-(4-ethoxyphenyl)-5-methyl-N-pyridin-3-yl-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135553779) has the molecular formula C29H30N6O5 and a molecular weight of 542.60 g/mol. Its IUPAC name is 7-(4-ethoxyphenyl)-5-methyl-N-pyridin-3-yl-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(4-ethoxyphenyl)-5-methyl-N-pyridin-3-yl-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135553779 |
| Molecular Formula | C29H30N6O5 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | 7-(4-ethoxyphenyl)-5-methyl-N-pyridin-3-yl-2-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CCOc1ccc(C2C(C(=O)Nc3cccnc3)=C(C)Nc3nc(-c4cc(OC)c(OC)c(OC)c4)nn32)cc1 |
| InChI | InChI=1S/C29H30N6O5/c1-6-40-21-11-9-18(10-12-21)25-24(28(36)32-20-8-7-13-30-16-20)17(2)31-29-33-27(34-35(25)29)19-14-22(37-3)26(39-5)23(15-19)38-4/h7-16,25H,6H2,1-5H3,(H,32,36)(H,31,33,34) |
| InChIKey | SFWIPKPIEWTODX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |