C9H6Cl2N4O — CID 135554432
4-amino-6-(2,5-dichlorophenyl)-1H-1,3,5-triazin-2-one (PubChem CID 135554432) has the molecular formula C9H6Cl2N4O and a molecular weight of 257.08 g/mol. Its IUPAC name is 4-amino-6-(2,5-dichlorophenyl)-1H-1,3,5-triazin-2-one.
| Compound Name | 4-amino-6-(2,5-dichlorophenyl)-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135554432 |
| Molecular Formula | C9H6Cl2N4O |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 4-amino-6-(2,5-dichlorophenyl)-1H-1,3,5-triazin-2-one |
| SMILES | Nc1nc(-c2cc(Cl)ccc2Cl)[nH]c(=O)n1 |
| InChI | InChI=1S/C9H6Cl2N4O/c10-4-1-2-6(11)5(3-4)7-13-8(12)15-9(16)14-7/h1-3H,(H3,12,13,14,15,16) |
| InChIKey | LIUAWCQCHQAWLT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |