C20H22N4O6 — CID 135555030
N,N'-bis[(E)-(2,4-dihydroxyphenyl)methylideneamino]hexanediamide (PubChem CID 135555030) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is N,N'-bis[(E)-(2,4-dihydroxyphenyl)methylideneamino]hexanediamide.
| Compound Name | N,N'-bis[(E)-(2,4-dihydroxyphenyl)methylideneamino]hexanediamide |
|---|---|
| PubChem CID | 135555030 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N,N'-bis[(E)-(2,4-dihydroxyphenyl)methylideneamino]hexanediamide |
| SMILES | O=C(CCCCC(=O)N/N=C/c1ccc(O)cc1O)N/N=C/c1ccc(O)cc1O |
| InChI | InChI=1S/C20H22N4O6/c25-15-7-5-13(17(27)9-15)11-21-23-19(29)3-1-2-4-20(30)24-22-12-14-6-8-16(26)10-18(14)28/h5-12,25-28H,1-4H2,(H,23,29)(H,24,30)/b21-11+,22-12+ |
| InChIKey | VTFWQVMCGXXZDV-XHQRYOPUSA-N |
| XLogP | 1.67 |
| TPSA | 163.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|