C23H23Cl2N3O3 — CID 135555218
4-(3,4-dichlorophenyl)-3-(2-hydroxyphenyl)-5-(3-propan-2-yloxypropyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one (PubChem CID 135555218) has the molecular formula C23H23Cl2N3O3 and a molecular weight of 460.36 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-3-(2-hydroxyphenyl)-5-(3-propan-2-yloxypropyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one.
| Compound Name | 4-(3,4-dichlorophenyl)-3-(2-hydroxyphenyl)-5-(3-propan-2-yloxypropyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
|---|---|
| PubChem CID | 135555218 |
| Molecular Formula | C23H23Cl2N3O3 |
| Molecular Weight | 460.36 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-3-(2-hydroxyphenyl)-5-(3-propan-2-yloxypropyl)-1,4-dihydropyrrolo[3,4-d]pyrazol-6-one |
| SMILES | CC(C)OCCCN1C(=O)c2[nH]nc(-c3ccccc3O)c2C1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H23Cl2N3O3/c1-13(2)31-11-5-10-28-22(14-8-9-16(24)17(25)12-14)19-20(26-27-21(19)23(28)30)15-6-3-4-7-18(15)29/h3-4,6-9,12-13,22,29H,5,10-11H2,1-2H3,(H,26,27) |
| InChIKey | LPHIKWZZCPMSOJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.36 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|