C17H15FN2O4S — CID 135555666
(2-fluorophenyl)methyl 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate (PubChem CID 135555666) has the molecular formula C17H15FN2O4S and a molecular weight of 362.38 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate.
| Compound Name | (2-fluorophenyl)methyl 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
|---|---|
| PubChem CID | 135555666 |
| Molecular Formula | C17H15FN2O4S |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (2-fluorophenyl)methyl 2-[(1,1-dioxo-1,2-benzothiazol-3-ylidene)amino]propanoate |
| SMILES | CC(/N=C1\NS(=O)(=O)c2ccccc21)C(=O)OCc1ccccc1F |
| InChI | InChI=1S/C17H15FN2O4S/c1-11(17(21)24-10-12-6-2-4-8-14(12)18)19-16-13-7-3-5-9-15(13)25(22,23)20-16/h2-9,11H,10H2,1H3,(H,19,20) |
| InChIKey | LWYPMUUWHXBNKY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|